CAS 669729-26-4

5-[4-(1-methylethyl)phenyl]-4-prop-2-en-1-yl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[4-(1-Methylethyl)phenyl]-4-prop-2-en-1-yl-2,4-dihydro-3H-1,2,4-triazole-3-thione, with the CAS number 669729-26-4, is a chemical compound characterized by its unique triazole structure, which includes a thione functional group. This compound features a substituted phenyl group, specifically a para-isopropyl group, contributing to its hydrophobic characteristics. The presence of the prop-2-en-1-yl group indicates that it has an alkene functionality, which may participate in various chemical reactions, such as polymerization or addition reactions. The triazole ring is known for its stability and is often found in pharmaceuticals and agrochemicals due to its biological activity. The thione group can enhance the compound's reactivity and potential applications in medicinal chemistry. Overall, this compound's structural features suggest it may exhibit interesting biological properties, making it a candidate for further research in drug development or agricultural applications.

Formula: C₁₄H₁₇N₃S

InChI: InChI=1/C14H17N3S/c1-4-9-17-13(15-16-14(17)18)12-7-5-11(6-8-12)10(2)3/h4-8,10H,1,9H2,2-3H3,(H,16,18)

SMILES: C=CCn1c(c2ccc(cc2)C(C)C)nnc1S

Synonyms:

• 4-Allyl-5-(4-isopropylphenyl)-4H-1,2,4-triazole-3-thiol

4-allyl-5-(4-isopropylphenyl)-4H-1,2,4-triazole-3-thiol

CAS: 669729-26-4

Formula: C₁₄H₁₇N₃S

Purity: 95.0%

Molecular weight: 259.37

Ref: 10-F307733