CAS 669737-43-3

5-[1-(4-methoxyphenoxy)ethyl]-4-prop-2-en-1-yl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[1-(4-Methoxyphenoxy)ethyl]-4-prop-2-en-1-yl-2,4-dihydro-3H-1,2,4-triazole-3-thione, with the CAS number 669737-43-3, is a chemical compound characterized by its unique triazole structure, which incorporates a thione functional group. This compound features a prop-2-en-1-yl group and a 4-methoxyphenoxyethyl moiety, contributing to its potential biological activity. The presence of the triazole ring suggests possible applications in pharmaceuticals, particularly in antifungal or antimicrobial agents, due to the known efficacy of triazole derivatives in these areas. The thione group may enhance its reactivity and interaction with biological targets. Additionally, the methoxy group can influence the compound's solubility and lipophilicity, affecting its pharmacokinetic properties. Overall, this compound's structural characteristics indicate a promising profile for further research and development in medicinal chemistry, although specific biological activity and toxicity data would require empirical investigation.

Formula: C₁₄H₁₇N₃O₂S

InChI: InChI=1/C14H17N3O2S/c1-4-9-17-13(15-16-14(17)20)10(2)19-12-7-5-11(18-3)6-8-12/h4-8,10H,1,9H2,2-3H3,(H,16,20)

SMILES: C=CCn1c(C(C)Oc2ccc(cc2)OC)nnc1S

4-allyl-5-[1-(4-methoxyphenoxy)ethyl]-4H-1,2,4-triazole-3-thiol

CAS: 669737-43-3

Formula: C₁₄H₁₇N₃O₂S

Purity: 95.0%

Molecular weight: 291.37

Ref: 10-F307818