CAS 669745-23-7

2-(2,3-dihydro-1H-inden-5-yloxy)propanehydrazide

Description:

2-(2,3-dihydro-1H-inden-5-yloxy)propanehydrazide, with the CAS number 669745-23-7, is a chemical compound characterized by its unique structural features, including a hydrazide functional group and an indene derivative. This compound typically exhibits properties associated with both hydrazides and aromatic systems, such as potential reactivity in condensation reactions and the ability to form hydrogen bonds due to the presence of the hydrazide moiety. The indene structure contributes to its stability and may influence its solubility and interaction with biological systems. Additionally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry. The presence of the ether linkage (the -O- group) suggests potential for further functionalization or reactivity under specific conditions. Overall, the characteristics of this compound make it a subject of interest for research in various fields, including organic synthesis and pharmacology.

Formula: C₁₂H₁₆N₂O₂

InChI: InChI=1/C12H16N2O2/c1-8(12(15)14-13)16-11-6-5-9-3-2-4-10(9)7-11/h5-8H,2-4,13H2,1H3,(H,14,15)

SMILES: CC(C(=NN)O)Oc1ccc2CCCc2c1

2-(2,3-Dihydro-1H-inden-5-yloxy)propanohydrazide

CAS: 669745-23-7

Formula: C₁₂H₁₆N₂O₂

Molecular weight: 220.2676

Ref: IN-DA006N03

2-(2,3-Dihydro-1H-inden-5-yloxy)propanohydrazide

CAS: 669745-23-7

Formula: C₁₂H₁₆N₂O₂

Purity: 95.0%

Molecular weight: 220.272

Ref: 10-F061425