CAS 669750-24-7

4-methyl-5-(1-phenoxyethyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

4-Methyl-5-(1-phenoxyethyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential biological activity. The presence of a phenoxyethyl group enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. The methyl group at the 4-position of the triazole ring can affect the compound's steric and electronic properties, potentially impacting its pharmacological profile. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and agricultural applications. Its specific properties, such as melting point, solubility, and stability, would depend on the molecular interactions and the environment in which it is studied. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₁H₁₃N₃OS

InChI: InChI=1/C11H13N3OS/c1-8(10-12-13-11(16)14(10)2)15-9-6-4-3-5-7-9/h3-8H,1-2H3,(H,13,16)

SMILES: CC(c1nnc(n1C)S)Oc1ccccc1

Synonyms:

• 4H-1,2,4-Triazole-3-thiol, 4-methyl-5-(1-phenoxyethyl)-
• 4-Methyl-5-(1-phenoxyethyl)-4H-1,2,4-triazole-3-thiol

4-Methyl-5-(1-phenoxyethyl)-4H-1,2,4-triazole-3-thiol

CAS: 669750-24-7

Formula: C₁₁H₁₃N₃OS

Purity: 95.0%

Molecular weight: 235.31

Ref: 10-F039084