CAS 669755-14-0

4-cyclopentyl-5-methyl-4H-1,2,4-triazole-3-thiol

Description:

4-Cyclopentyl-5-methyl-4H-1,2,4-triazole-3-thiol is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a cyclopentyl group and a methyl group, contributing to its unique properties and potential applications. The presence of a thiol (-SH) functional group indicates that it can participate in various chemical reactions, including nucleophilic substitutions and redox reactions. The compound's structure suggests it may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of antifungal or antimicrobial agents. Additionally, the triazole moiety is known for its ability to form coordination complexes with metal ions, which could enhance its utility in materials science or catalysis. Overall, 4-cyclopentyl-5-methyl-4H-1,2,4-triazole-3-thiol is a versatile compound with potential applications across various fields, including medicinal chemistry and materials science.

Formula: C₈H₁₃N₃S

InChI: InChI=1/C8H13N3S/c1-6-9-10-8(12)11(6)7-4-2-3-5-7/h7H,2-5H2,1H3,(H,10,12)

SMILES: Cc1nnc(n1C1CCCC1)S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 4-cyclopentyl-5-methyl-

4-cyclopentyl-5-methyl-4H-1,2,4-triazole-3-thiol

CAS: 669755-14-0

Formula: C₈H₁₃N₃S

Purity: 95.0%

Molecular weight: 183.27

Ref: 10-F309169