CAS 6698-13-1

4-bromo-1,3-benzodioxole

Description:

4-Bromo-1,3-benzodioxole is an organic compound characterized by its unique structure, which consists of a benzodioxole core with a bromine substituent at the 4-position. This compound features a fused dioxole ring, contributing to its aromatic properties and potential reactivity. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the bromine atom enhances its electrophilic character, making it a useful intermediate in various chemical reactions, including electrophilic aromatic substitution. 4-Bromo-1,3-benzodioxole is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its solubility in organic solvents and relatively low water solubility are notable characteristics, influencing its application in different chemical environments. Additionally, safety precautions should be observed when handling this compound, as brominated compounds can pose health risks. Overall, 4-bromo-1,3-benzodioxole is a valuable compound in synthetic organic chemistry, with diverse applications owing to its structural features and reactivity.

Formula: C₇H₅BrO₂

InChI: InChI=1/C7H5BrO2/c8-5-2-1-3-6-7(5)10-4-9-6/h1-3H,4H2

SMILES: c1cc(c2c(c1)OCO2)Br

Synonyms:

• 4-Bromobenzo[D][1,3]Dioxole

4-Bromo-1,3-benzodioxole

CAS: 6698-13-1

Formula: C₇H₅BrO₂

Purity: 96%

Color and Shape: Liquid

Molecular weight: 201.0174

Ref: IN-DA00365A

4-Bromo-1,3-benzodioxole

CAS: 6698-13-1

4-Bromo-1,3-benzodioxole

Formula: C₇H₅BrO₂

Purity: ≥95%

Color and Shape: white fused solid

Molecular weight: 201.02g/mol

Ref: 54-OR23021

4-Bromo-1,3-benzodioxole

CAS: 6698-13-1

Formula: C₇H₅BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 201.019

Ref: 10-F079750