CAS 6698-26-6
:2',5'-dideoxyadenosine
Description:
2',5'-Dideoxyadenosine is a nucleoside analog of adenosine, characterized by the absence of hydroxyl groups at the 2' and 5' positions of the ribose sugar. This modification imparts unique properties to the molecule, making it a valuable compound in biochemical research and pharmaceutical applications. The chemical formula of 2',5'-dideoxyadenosine reflects its structure, which consists of a purine base (adenine) linked to a modified sugar. This compound is known for its role in inhibiting viral replication and has been studied for its potential use in antiviral therapies, particularly against retroviruses. Additionally, its lack of hydroxyl groups makes it resistant to certain enzymatic degradation processes, enhancing its stability in biological systems. The CAS number 6698-26-6 uniquely identifies this compound in chemical databases, facilitating its study and application in various scientific fields. Overall, 2',5'-dideoxyadenosine serves as an important tool in molecular biology and medicinal chemistry, contributing to our understanding of nucleoside function and therapeutic development.
Formula:C10H13N5O2
InChI:InChI=1/C10H13N5O2/c1-5-6(16)2-7(17-5)15-4-14-8-9(11)12-3-13-10(8)15/h3-7,16H,2H2,1H3,(H2,11,12,13)/t5-,6+,7-/m1/s1
Synonyms:- Adenosine, 2',5'-Dideoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2',5'-Dideoxyadenosine
CAS:2',5'-Dideoxyadenosine is a potent and non-competitive adenylyl cyclase inhibitor via binding the P-site (IC50: 3 μM).Formula:C10H13N5O2Purity:99.55%Color and Shape:White SolidMolecular weight:235.24Ref: TM-T10066
1mg39.00€5mg84.00€10mg119.00€25mg210.00€50mg354.00€100mg562.00€500mg1,225.00€1mL*10mM (DMSO)92.00€2',5'-Dideoxyadenosine
CAS:Formula:C10H13N5O2Purity:99%Color and Shape:SolidMolecular weight:235.24252'',5''-Dideoxyadenosine
CAS:Formula:C10H13N5O2Purity:≥ 96.0%Color and Shape:White to off-white powderMolecular weight:235.242',5'-Dideoxyadenosine
CAS:2',5'-Dideoxyadenosine is a nucleotide analog that inhibits the enzyme adenylate cyclase, by binding non-competitively via the P-site
Formula:C10H13N5O2Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:235.25 g/molRef: 3D-ND07997
Discontinued product





