CAS 6698-46-0

5-O-benzoyl-1,2-O-(1-methylethylidene)pentofuranos-3-ulose

Description:

5-O-benzoyl-1,2-O-(1-methylethylidene)pentofuranos-3-ulose, with the CAS number 6698-46-0, is a chemical compound that belongs to the class of furanosides, which are sugars that contain a furan ring. This compound is characterized by the presence of a benzoyl group, which contributes to its aromatic properties and can influence its reactivity and solubility. The methylethylidene group indicates a specific stereochemistry that can affect the compound's biological activity and interactions. As a pentofuranoside, it is derived from a five-carbon sugar, which is significant in various biochemical processes. The compound may exhibit properties such as being a potential intermediate in organic synthesis or having applications in pharmaceuticals or biochemistry due to its structural features. Its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, this compound's unique structure makes it of interest in both synthetic and applied chemistry contexts.

Formula: C₁₅H₁₆O₆

InChI: InChI=1/C15H16O6/c1-15(2)20-12-11(16)10(19-14(12)21-15)8-18-13(17)9-6-4-3-5-7-9/h3-7,10,12,14H,8H2,1-2H3

SMILES: CC1(C)OC2C(=O)C(COC(=O)c3ccccc3)OC2O1

Synonyms:

• 1,2-O-Isopropylidene-5-Benzoate-Alpha-D-Erythro-Pentofuranos-3-Ulose
• 5-O-Benzoyl-1,2-O-(1-methylethylidene)pentofuranos-3-ulose

5-O-benzoyl-1,2-O-isopropylidene-α-D-erythro-pent-3-ulofuranose

CAS: 6698-46-0

5-O-benzoyl-1,2-O-isopropylidene-alpha-D-erythro-pent-3-ulofuranose is a Carbohydrate; Used for modified nucleoside.

Formula: C₁₅H₁₆O₆

Color and Shape: Solid

Molecular weight: 292.28

Ref: TM-TNU0608

5-O-Benzoyl-1,2-O-isopropylidene-3-keto-a-D-xylofuranoside

Controlled Product

CAS: 6698-46-0

Formula: C₁₅H₁₆O₆

Color and Shape: Neat

Molecular weight: 292.284

Ref: TR-O210470

5-O-Benzoyl-1,2-O-isopropylidene-3-keto-α-D-xylofuranoside

CAS: 6698-46-0

5-O-Benzoyl-1,2-O-isopropylidene 3-keto a D xylofuranoside is a custom synthesis of an oligosaccharide, polysaccharide, saccharide, or carbohydrate. It is a high purity compound with a modification of fluorination and click chemistry. This synthesis can be used for research purposes.

Formula: C₁₅H₁₆O₆

Purity: Min. 95%

Molecular weight: 292.28 g/mol

Ref: 3D-MB15523