CAS 66990-32-7
:10,12-Pentacosadiynoic acid
Description:
10,12-Pentacosadiynoic acid, with the CAS number 66990-32-7, is a long-chain fatty acid characterized by its unique structure featuring a 25-carbon backbone and two conjugated triple bonds located at the 10th and 12th positions. This compound is part of the class of diacetylenic fatty acids, which are known for their interesting physical and chemical properties, including the ability to form stable polymeric structures upon exposure to UV light. The presence of the conjugated triple bonds contributes to its reactivity and potential applications in materials science, particularly in the development of photonic and electronic materials. Additionally, 10,12-pentacosadiynoic acid exhibits amphiphilic characteristics, allowing it to interact with both hydrophilic and hydrophobic environments, which is beneficial for applications in drug delivery and nanotechnology. Its unique properties make it a subject of interest in various fields, including biochemistry and polymer science, where it can be utilized in the synthesis of novel materials with tailored functionalities.
Formula:C25H42O2
InChI:InChI=1S/C25H42O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25(26)27/h2-12,17-24H2,1H3,(H,26,27)
InChI key:InChIKey=ZPUDRBWHCWYMQS-UHFFFAOYSA-N
SMILES:C(CC#CC#CCCCCCCCCCCCC)CCCCCCC(O)=O
Synonyms:- 10,12-Pentacosadiynioic acid
- Da 3261
- Pentacosa-10,12-Diynoic Acid
- 10,12-Pentacosadiynoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
10,12-Pentacosadiynoic acid, 98+%
CAS:<p>10,12-Pentacosadiynoic acid is used in the preparation of colorimetric and fluorescence sensors for cationic surfactants. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. Th</p>Formula:C25H42O2Purity:98+%Color and Shape:Crystalline powder, Pale blue to blueMolecular weight:374.61Pentacosa-10,12-diynoic acid
CAS:Formula:C25H42O2Purity:97%Color and Shape:SolidMolecular weight:374.599810,12-Pentacosadiynoic Acid
CAS:Formula:C25H42O2Purity:>97.0%(GC)(T)Color and Shape:White to Gray to Dark blue powder to crystalMolecular weight:374.6110,12-Pentacosadiynoic acid
CAS:Formula:C25H42O2Purity:97%Color and Shape:Solid, White to bluish grey powderMolecular weight:374.609




