CymitQuimica logo

CAS 66999-52-8

:

Propanoic acid, 2-(6-chloro-2-pyridinyl)hydrazide

Description:
Propanoic acid, 2-(6-chloro-2-pyridinyl)hydrazide, identified by CAS number 66999-52-8, is a chemical compound that features a propanoic acid moiety linked to a hydrazide functional group, which is further substituted with a 6-chloro-2-pyridinyl group. This compound typically exhibits characteristics common to hydrazides, such as the ability to form hydrogen bonds due to the presence of the hydrazide functional group, which can influence its solubility and reactivity. The presence of the pyridine ring introduces aromaticity and may enhance the compound's biological activity, making it of interest in pharmaceutical applications. Additionally, the chlorine substituent can affect the electronic properties and reactivity of the molecule. In terms of physical properties, it is likely to be a solid at room temperature, with potential solubility in polar solvents. The compound may also exhibit specific reactivity patterns typical of hydrazides, such as the ability to undergo condensation reactions or participate in the formation of various derivatives. Overall, its unique structure suggests potential utility in medicinal chemistry and related fields.
Formula:C8H10ClN3O
InChI:InChI=1S/C8H10ClN3O/c1-2-8(13)12-11-7-5-3-4-6(9)10-7/h3-5H,2H2,1H3,(H,10,11)(H,12,13)
InChI key:InChIKey=VUUNEPUYJVEQRI-UHFFFAOYSA-N
SMILES:N(NC(CC)=O)C=1N=C(Cl)C=CC1
Synonyms:
  • NSC 289810
  • Propanoic acid, 2-(6-chloro-2-pyridinyl)hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.