CAS 67-16-3: Thiamine disulfide
Description:Thiamine disulfide, also known as thiamine or vitamin B1, is a water-soluble vitamin that plays a crucial role in carbohydrate metabolism and is essential for maintaining proper nerve function. It is characterized by its yellow crystalline appearance and is sensitive to heat and light, which can lead to degradation. Thiamine disulfide is involved in the decarboxylation of alpha-keto acids and is a coenzyme for several important enzymatic reactions, including those in the citric acid cycle. Its deficiency can lead to conditions such as beriberi and Wernicke-Korsakoff syndrome, which affect the cardiovascular and nervous systems, respectively. Thiamine is commonly found in foods such as whole grains, legumes, nuts, and meat. In terms of solubility, it is soluble in water but less so in organic solvents. The compound is generally considered safe when consumed in appropriate amounts, but excessive intake can lead to adverse effects. Overall, thiamine disulfide is vital for energy metabolism and overall health.
Formula:C24H34N8O4S2
InChI:InChI=1S/C24H34N8O4S2/c1-15(31(13-35)11-19-9-27-17(3)29-23(19)25)21(5-7-33)37-38-22(6-8-34)16(2)32(14-36)12-20-10-28-18(4)30-24(20)26/h9-10,13-14,33-34H,5-8,11-12H2,1-4H3,(H2,25,27,29)(H2,26,28,30)
InChI key:InChIKey=GFEGEDUIIYDMOX-UHFFFAOYSA-N
SMILES:O=CN(C(=C(SSC(=C(N(C=O)CC1=CN=C(N=C1N)C)C)CCO)CCO)C)CC2=CN=C(N=C2N)C
- Synonyms:
- Aktivin
- Algoneurina
- Alitia S
- Aneurin disulfide
- Aneurine disulfide
- Apren S
- Daiomin
- Daisazin
- Feidmin 5
- Formamide, N,N′-[dithiobis[2-(2-hydroxyethyl)-1-methyl-2,1-ethenediyl]]bis[N-[(4-amino-2-methyl-5-pyrimidinyl)methyl]-
- See more synonyms
- Formamide, N,N′-[dithiobis[2-(2-hydroxyethyl)-1-methylvinylene]]bis[N-[(4-amino-2-methyl-5-pyrimidinyl)methyl]-
- Lowei
- N,N'-[disulfanediylbis(5-hydroxypent-2-ene-3,2-diyl)]bis{N-[(4-amino-2-methylpyrimidin-5-yl)methyl]formamide}
- N,N'-{disulfanediylbis[(2E)-5-hydroxypent-2-ene-3,2-diyl]}bis{N-[(4-amino-2-methylpyrimidin-5-yl)methyl]formamide}
- N,N'-{disulfanediylbis[(2Z)-5-hydroxypent-2-ene-3,2-diyl]}bis{N-[(4-amino-2-methylpyrimidin-5-yl)methyl]formamide}
- N,N′-[Dithiobis[2-(2-hydroxyethyl)-1-methyl-2,1-ethenediyl]]bis[N-[(4-amino-2-methyl-5-pyrimidinyl)methyl]formamide]
- N,N′-[Dithiobis[2-(2-hydroxyethyl)-1-methylvinylene]]bis[N-[(4-amino-2-methyl-5-pyrimidinyl)methyl]formamide
- Neolamin
- SSB<sub>1</sub>
- Ssb1
- TDS (neurotrope)
- Thiamidin F
- Thiamin disulfide
- Thiaminedisulfide
- Vitamin B<sub>1</sub> disulfide
