CAS 670-83-7

2,4-Diphenylimidazole

Description:

2,4-Diphenylimidazole is an organic compound characterized by its imidazole ring, which is substituted at the 2 and 4 positions with phenyl groups. This compound typically appears as a white to light yellow crystalline solid and is known for its stability and relatively low solubility in water, but it is soluble in organic solvents such as ethanol and acetone. It exhibits properties that make it useful in various applications, including as a potential antioxidant and in photochemical studies. The presence of the imidazole moiety contributes to its biological activity, and it may interact with biological systems, making it of interest in medicinal chemistry. Additionally, 2,4-Diphenylimidazole can participate in various chemical reactions, including those involving nucleophilic substitutions and coordination with metal ions. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate safety measures to avoid inhalation or skin contact. Overall, 2,4-Diphenylimidazole is a versatile compound with significant implications in both research and industrial applications.

Formula: C₁₅H₁₂N₂

InChI: InChI=1/C15H12N2/c1-3-7-12(8-4-1)14-11-16-15(17-14)13-9-5-2-6-10-13/h1-11H,(H,16,17)

SMILES: c1ccc(cc1)c1cnc(c2ccccc2)[nH]1

Synonyms:

• 2,4-Diphenyl-1H-imidazole
• 2,5-diphenyl-1H-imidazole

1H-Imidazole, 2,4-diphenyl-

CAS: 670-83-7

Formula: C₁₅H₁₂N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 220.2692

Ref: IN-DA00IBNY

2,4-Diphenyl-1H-imidazole

CAS: 670-83-7

Purity: 97.0%

Color and Shape: Solid

Molecular weight: 220.27499389648438

Ref: 10-F068691

2,4-Diphenyl-1H-imidazole

CAS: 670-83-7

2,4-Diphenyl-1H-imidazole

Formula: C₁₅H₁₂N₂

Purity: 99%

Color and Shape: off-white solid

Molecular weight: 220.27g/mol

Ref: 54-OR2884