CymitQuimica logo

CAS 6700-17-0

:

sodium propanoate hydrate (1:1:1)

Description:
Sodium propanoate hydrate, with the CAS number 6700-17-0, is a sodium salt of propanoic acid, commonly known as sodium propionate. This compound typically appears as a white crystalline solid and is hygroscopic, meaning it can absorb moisture from the environment. The "hydrate" designation indicates that it contains water molecules in its crystalline structure, which can influence its physical properties and stability. Sodium propanoate is soluble in water, making it useful in various applications, including as a food preservative due to its ability to inhibit mold and bacterial growth. It is also utilized in biochemical research and as a buffering agent in laboratory settings. The compound is generally regarded as safe for consumption in regulated amounts, but like all chemicals, it should be handled with care, following appropriate safety guidelines. Its properties, such as melting point and solubility, can vary depending on the specific hydrate form and environmental conditions.
Formula:C3H7NaO3
InChI:InChI=1/C3H6O2.Na.H2O/c1-2-3(4)5;;/h2H2,1H3,(H,4,5);;1H2/q;+1;/p-1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.