CymitQuimica logo

CAS 6700-95-4

:

1-Butanamine, N-(1-methylethylidene)-

Description:
1-Butanamine, N-(1-methylethylidene)-, also known as N-isobutyl-1-butanamine, is an organic compound characterized by its amine functional group and a branched alkyl chain. It features a butyl group attached to a nitrogen atom, which is further substituted with an isobutylene group. This structure imparts specific properties such as moderate polarity due to the presence of the amine group, which can engage in hydrogen bonding. The compound is typically a colorless to pale yellow liquid with a distinct amine odor. It is soluble in organic solvents and exhibits limited solubility in water, reflecting its hydrophobic characteristics. The presence of the nitrogen atom allows it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, 1-butanamine derivatives are often utilized in the synthesis of pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. Safety data indicates that, like many amines, it may be irritating to skin and eyes, necessitating appropriate handling precautions.
Formula:C7H15N
InChI:InChI=1S/C7H15N/c1-4-5-6-8-7(2)3/h4-6H2,1-3H3
InChI key:CFSQDRBJTRXPQH-UHFFFAOYSA-N
SMILES:CCCCN=C(C)C
Found 1 products.