CAS 67000-27-5

2-(3,5-diphenyl-1H-pyrazol-1-yl)ethanol

Description:

2-(3,5-Diphenyl-1H-pyrazol-1-yl)ethanol is an organic compound characterized by its pyrazole ring structure, which is substituted with two phenyl groups at the 3 and 5 positions, and an ethanol moiety at the 2 position. This compound typically exhibits properties such as moderate solubility in organic solvents and potential interactions with biological systems due to its functional groups. The presence of the hydroxyl (-OH) group in the ethanol part contributes to its ability to form hydrogen bonds, influencing its reactivity and solubility. Additionally, the diphenyl substitution can enhance its stability and may impart unique electronic properties, making it of interest in various fields, including medicinal chemistry and materials science. The compound may also exhibit specific biological activities, which can be explored further in pharmacological studies. Overall, 2-(3,5-diphenyl-1H-pyrazol-1-yl)ethanol represents a versatile structure with potential applications in research and industry.

Formula: C₁₇H₁₆N₂O

InChI: InChI=1/C17H16N2O/c20-12-11-19-17(15-9-5-2-6-10-15)13-16(18-19)14-7-3-1-4-8-14/h1-10,13,20H,11-12H2

SMILES: c1ccc(cc1)c1cc(c2ccccc2)n(CCO)n1

Synonyms:

• 1H-pyrazole-1-ethanol, 3,5-diphenyl-

2-(3,5-Diphenyl-1H-pyrazol-1-yl)ethan-1-ol

CAS: 67000-27-5

2-(3,5-Diphenyl-1H-pyrazol-1-yl)ethan-1-ol is a synthetic ligand that binds to proton receptors. It has been shown to be hypoglycemic in rats and to have hypotensive effects in rabbits. This drug also has antiarrhythmic properties, which may be due to its ability to inhibit platelet aggregation. 2-(3,5-Diphenyl-1H-pyrazol-1-yl)ethan-1-ol can be used as an analytical method for the determination of chalcone and bond cleavage products in epoxide analysis.

Formula: C₁₇H₁₆N₂O

Purity: Min. 95%

Molecular weight: 264.32 g/mol

Ref: 3D-SCA00027