CAS 67003-48-9

4-[(methylsulfanyl)methyl]benzoic acid

Description:

4-[(Methylsulfanyl)methyl]benzoic acid, with the CAS number 67003-48-9, is an organic compound characterized by its benzoic acid structure modified with a methylsulfanyl group. This compound features a benzoic acid moiety, which consists of a benzene ring attached to a carboxylic acid group (-COOH), and a methylsulfanyl group (-S-CH3) that is linked to the benzene ring at the para position relative to the carboxylic acid. The presence of the methylsulfanyl group imparts unique properties, such as potential for increased solubility in organic solvents and possible reactivity in various chemical reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Overall, 4-[(methylsulfanyl)methyl]benzoic acid is a versatile compound with applications in various fields, including medicinal chemistry and materials science.

Formula: C₉H₁₀O₂S

InChI: InChI=1/C9H10O2S/c1-12-6-7-2-4-8(5-3-7)9(10)11/h2-5H,6H2,1H3,(H,10,11)

SMILES: CSCc1ccc(cc1)C(=O)O

Synonyms:

• 4-[(Methylthio)Methyl]Benzoic Acid

4-[(Methylsulfanyl)methyl]benzoic acid

CAS: 67003-48-9

Formula: C₉H₁₀O₂S

Molecular weight: 182.2395

Ref: IN-DA005RGO

4-[(Methylsulfanyl)methyl]benzoic acid

CAS: 67003-48-9

4-[(Methylsulfanyl)methyl]benzoic acid

Purity: 98%

Molecular weight: 182.24g/mol

Ref: 54-OR954025

4-[(Methylsulfanyl)methyl]benzoic acid

CAS: 67003-48-9

Purity: 95%

Molecular weight: 182.2400055

Ref: 10-F639120

4-[(Methylsulfanyl)methyl]benzoic acid

CAS: 67003-48-9

4-[(Methylsulfanyl)methyl]benzoic acid is a chiral compound with a sulfur atom. It can be prepared by the reaction between methylsulfonyl chloride and benzoyl chloride in chloroform or by the reaction of methoxysulfur trifluoride with benzoic acid. 4-[(Methylsulfanyl)methyl]benzoic acid can also be synthesized by the reaction of sulfone and carboxylic acid derivatives, such as benzyl or cyano. 4-[(Methylsulfanyl)methyl]benzoic acid is used as a fungicide, insecticide, and herbicide. The substituents on this molecule are able to form bonds with other molecules to create an array of different structures. The most common substitution is for methoxy, which has a hydroxy group attached to it. This substitution is found in many different types of molecules including some drugs, hormones, vitamins,

Formula: C₉H₁₀O₂S

Purity: Min. 95%

Molecular weight: 182.24 g/mol

Ref: 3D-SCA00348