CAS 67003-50-3

4-(methoxymethyl)benzoic acid

Description:

4-(Methoxymethyl)benzoic acid, with the CAS number 67003-50-3, is an aromatic carboxylic acid characterized by the presence of a benzoic acid core substituted with a methoxymethyl group at the para position. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while its solubility in water may vary depending on conditions. The methoxymethyl group enhances its chemical reactivity, making it useful in various synthetic applications, including the production of polymers and pharmaceuticals. The presence of the carboxylic acid functional group contributes to its acidity and potential for forming hydrogen bonds, which can influence its interactions in biological systems and materials science. Additionally, this compound may exhibit specific physical properties such as melting and boiling points, which are essential for its handling and application in laboratory settings. Overall, 4-(methoxymethyl)benzoic acid is a versatile compound with potential utility in organic synthesis and material development.

Formula: C₉H₁₀O₃

InChI: InChI=1/C9H10O3/c1-12-6-7-2-4-8(5-3-7)9(10)11/h2-5H,6H2,1H3,(H,10,11)

SMILES: COCc1ccc(cc1)C(=O)O

Synonyms:

• Benzoic Acid, 4-(Methoxymethyl)-
• 4-(Methoxymethyl)Benzoate
• 4-(methoxymethyl)benzoic acid(SALTDATA: FREE)

4-(Methoxymethyl)benzoic acid

CAS: 67003-50-3

Formula: C₉H₁₀O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 166.1739

Ref: IN-DA006MYW

4-(Methoxymethyl)benzoic acid

CAS: 67003-50-3

4-(Methoxymethyl)benzoic acid

Purity: 95%

Molecular weight: 166.17g/mol

Ref: 54-OR954026

4-(Methoxymethyl)benzoic acid

Controlled Product

CAS: 67003-50-3

Applications 4-(Methoxymethyl)benzoic acid

Formula: C₉H₁₀O₃

Color and Shape: Neat

Molecular weight: 166.174

Ref: TR-M329835

4-Methoxymethyl-benzoic acid

CAS: 67003-50-3

Formula: C₉H₁₀O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 166.176

Ref: 10-F060270