CAS 67005-97-4

9-pentofuranosyl-N-(prop-2-yn-1-yl)-9H-purin-6-amine

Description:

9-Pentofuranosyl-N-(prop-2-yn-1-yl)-9H-purin-6-amine, identified by its CAS number 67005-97-4, is a purine derivative that features a furanosyl sugar moiety and an alkyne substituent. This compound is characterized by its structural components, which include a purine base, specifically adenine, linked to a pentofuranosyl group, contributing to its nucleoside-like properties. The presence of the prop-2-yn-1-yl group introduces unique reactivity due to the alkyne functionality, which can participate in various chemical reactions, including click chemistry. This compound may exhibit biological activity, potentially influencing nucleic acid metabolism or serving as a building block in the synthesis of nucleoside analogs. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, this compound represents a significant interest in medicinal chemistry and biochemistry, particularly in the development of antiviral or anticancer agents.

Formula: C₁₃H₁₅N₅O₄

InChI: InChI=1/C13H15N5O4/c1-2-3-14-11-8-12(16-5-15-11)18(6-17-8)13-10(21)9(20)7(4-19)22-13/h1,5-7,9-10,13,19-21H,3-4H2,(H,14,15,16)

SMILES: C#CCNc1c2c(ncn1)n(cn2)C1C(C(C(CO)O1)O)O

N6-(2-Propynyl)adenosine

CAS: 67005-97-4

N6-(2-Propynyl)adenosine is a Nucleoside Derivative - 6-Modified purine nucleoside.

Formula: C₁₃H₁₅N₅O₄

Color and Shape: Solid

Molecular weight: 305.29

Ref: TM-TNU0341

N6-Propargyladenosine

CAS: 67005-97-4

N6-Propargyladenosine is an alkyne functionalised nucleoside.

Formula: C₁₃H₁₅N₅O₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 305.29 g/mol

Ref: 3D-NP30546