CAS 67021-83-4

1H-benzimidazol-4-ol

Description:

1H-benzimidazol-4-ol, with the CAS number 67021-83-4, is a heterocyclic organic compound characterized by its fused benzene and imidazole rings, featuring a hydroxyl group at the 4-position of the benzimidazole structure. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydroxyl group. It exhibits properties that make it of interest in various fields, including medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals due to its potential biological activity. The compound can participate in hydrogen bonding due to the hydroxyl group, influencing its reactivity and interactions with other molecules. Additionally, 1H-benzimidazol-4-ol may exhibit fluorescence, making it useful in certain analytical applications. Its stability and reactivity can vary depending on the conditions, such as pH and temperature, which are important considerations in its practical applications.

Formula: C₇H₆N₂O

InChI: InChI=1/C7H6N2O/c10-6-3-1-2-5-7(6)9-4-8-5/h1-4,10H,(H,8,9)

SMILES: c1cc2c(c(c1)O)[nH]cn2

Synonyms:

• 1H-Benzoimidazol-4-ol

1H-Benzo[d]imidazol-4-ol

CAS: 67021-83-4

Formula: C₇H₆N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 134.1353

Ref: IN-DA0064JY

1H-Benzoimidazol-4-ol

CAS: 67021-83-4

1H-Benzoimidazol-4-ol

Formula: C₇H₆N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 134.14g/mol

Ref: 54-OR943594

4-Hydroxybenzimidazole

CAS: 67021-83-4

Formula: C₇H₆N₂O

Purity: >98.0%(GC)(T)

Color and Shape: White to Gray to Brown powder to crystal

Molecular weight: 134.14

Ref: 3B-H1547

1H-Benzo[d]imidazol-4-ol

CAS: 67021-83-4

Formula: C₇H₆N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 134.138

Ref: 10-F241143