CAS 670255-96-6

N-[(2,4-dimethylphenyl)sulfonyl]glycine

Description:

N-[(2,4-dimethylphenyl)sulfonyl]glycine is an organic compound characterized by the presence of a sulfonyl group attached to a glycine molecule, with a 2,4-dimethylphenyl substituent. This compound features a sulfonamide functional group, which is known for its biological activity and potential pharmaceutical applications. The presence of the dimethylphenyl group contributes to its lipophilicity, potentially influencing its solubility and permeability in biological systems. The glycine moiety provides a basic amino acid structure, which may play a role in interactions with biological targets. This compound may exhibit properties such as moderate stability under standard conditions, but its reactivity can vary depending on the surrounding environment, particularly in the presence of nucleophiles or under acidic or basic conditions. Its specific applications and biological activities would depend on further studies, but compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects.

Formula: C₁₀H₁₃NO₄S

InChI: InChI=1/C10H13NO4S/c1-7-3-4-9(8(2)5-7)16(14,15)11-6-10(12)13/h3-5,11H,6H2,1-2H3,(H,12,13)

SMILES: Cc1ccc(c(C)c1)S(=O)(=O)NCC(=O)O

[[(2,4-DIMETHYLPHENYL)SULFONYL]AMINO]ACETIC ACID

CAS: 670255-96-6

Formula: C₁₀H₁₃NO₄S

Purity: 95%

Color and Shape: Solid

Molecular weight: 243.2795

Ref: IN-DA00FCI0

2-(2,4-Dimethylphenylsulfonamido)acetic acid

CAS: 670255-96-6

2-(2,4-Dimethylphenylsulfonamido)acetic acid

Purity: 95%

Molecular weight: 243.28g/mol

Ref: 54-OR1052088

N-[(2,4-dimethylphenyl)sulfonyl]glycine

CAS: 670255-96-6

Formula: C₁₀H₁₃NO₄S

Purity: 95%

Molecular weight: 243.28

Ref: 10-F315509