CAS 670260-30-7

N-[(4-Fluoro-2-methylphenyl)sulfonyl]glycine

Description:

N-[(4-Fluoro-2-methylphenyl)sulfonyl]glycine, with the CAS number 670260-30-7, is a chemical compound characterized by its sulfonamide functional group, which is linked to a glycine moiety. This compound features a 4-fluoro-2-methylphenyl group, contributing to its unique properties and potential biological activity. The presence of the sulfonyl group enhances its solubility and reactivity, making it of interest in medicinal chemistry and pharmaceutical research. Typically, compounds like this may exhibit properties such as antibacterial or anti-inflammatory activities, although specific biological effects would depend on further empirical studies. The molecular structure suggests that it may participate in hydrogen bonding and other intermolecular interactions, influencing its behavior in various chemical environments. Additionally, the fluorine atom can affect the compound's lipophilicity and metabolic stability. Overall, N-[(4-Fluoro-2-methylphenyl)sulfonyl]glycine represents a class of compounds that could have significant implications in drug development and therapeutic applications.

Formula: C₉H₁₀FNO₄S

InChI: InChI=1S/C9H10FNO4S/c1-6-4-7(10)2-3-8(6)16(14,15)11-5-9(12)13/h2-4,11H,5H2,1H3,(H,12,13)

InChI key: InChIKey=GKTIRCMUAIDOMF-UHFFFAOYSA-N

SMILES: S(NCC(O)=O)(=O)(=O)C1=C(C)C=C(F)C=C1

Synonyms:

• Glycine, N-[(4-fluoro-2-methylphenyl)sulfonyl]-
• {[(4-Fluoro-2-Methylphenyl)Sulfonyl]Amino}Acetic Acid
• N-[(4-Fluoro-2-methylphenyl)sulfonyl]glycine

N-[(4-fluoro-2-methylphenyl)sulfonyl]glycine

CAS: 670260-30-7

Formula: C₉H₁₀FNO₄S

Purity: 95.0%

Molecular weight: 247.24

Ref: 10-F315554