CAS 670271-04-2

methyl 2-amino-4-(furan-2-yl)thiophene-3-carboxylate

Description:

Methyl 2-amino-4-(furan-2-yl)thiophene-3-carboxylate is an organic compound characterized by its unique structure, which includes a thiophene ring, an amino group, and a furan moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, such as potential biological activity and the ability to participate in various chemical reactions. The presence of the amino group suggests it may engage in hydrogen bonding, influencing its solubility and reactivity. The carboxylate ester functionality can also contribute to its reactivity, making it a potential candidate for further chemical modifications. Additionally, the furan ring may impart specific electronic properties, enhancing its potential applications in pharmaceuticals or materials science. Overall, this compound's structural features suggest it could be of interest in medicinal chemistry, particularly for developing new therapeutic agents or as a building block in organic synthesis.

Formula: C₁₀H₉NO₃S

InChI: InChI=1/C10H9NO3S/c1-13-10(12)8-6(5-15-9(8)11)7-3-2-4-14-7/h2-5H,11H2,1H3

SMILES: COC(=O)c1c(csc1N)c1ccco1

Synonyms:

• 3-Thiophenecarboxylic Acid, 2-Amino-4-(2-Furanyl)-, Methyl Ester
• Methyl 2-amino-4-(2-furyl)thiophene-3-carboxylate

methyl 2-amino-4-(2-furyl)thiophene-3-carboxylate

CAS: 670271-04-2

Formula: C₁₀H₉NO₃S

Purity: 90.0%

Color and Shape: Solid, Crystalline

Molecular weight: 223.25

Ref: 10-F307628