CymitQuimica logo

CAS 67032-05-7

:

1-{3-[(2-hydroxybenzoyl)oxy]propyl}-2-methylpiperidinium chloride

Description:
1-{3-[(2-hydroxybenzoyl)oxy]propyl}-2-methylpiperidinium chloride, with the CAS number 67032-05-7, is a quaternary ammonium compound characterized by its piperidine structure, which includes a methyl group and a propyl chain substituted with a 2-hydroxybenzoyl group. This compound typically exhibits properties such as solubility in water and organic solvents, making it versatile for various applications. Its quaternary ammonium nature suggests it may possess surfactant properties, potentially allowing it to interact with biological membranes or act as a stabilizing agent in formulations. The presence of the hydroxyl group in the benzoyl moiety may contribute to its reactivity and ability to form hydrogen bonds, influencing its biological activity and solubility. Additionally, the chloride ion serves as a counterion, which can affect the compound's overall stability and solubility in different environments. Overall, this compound may have applications in pharmaceuticals, biochemistry, or as a reagent in organic synthesis, though specific applications would depend on further research and characterization.
Formula:C16H24ClNO3
InChI:InChI=1/C16H23NO3.ClH/c1-13-7-4-5-10-17(13)11-6-12-20-16(19)14-8-2-3-9-15(14)18;/h2-3,8-9,13,18H,4-7,10-12H2,1H3;1H
Synonyms:
  • Salicylic acid, 3-(2-methylpiperidino)propyl ester, hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.