CAS 67058-71-3: 1-(1H-pyrrolo[2,3-c]pyridin-3-yl)ethanone

Description:1-(1H-pyrrolo[2,3-c]pyridin-3-yl)ethanone, with the CAS number 67058-71-3, is a chemical compound characterized by its unique bicyclic structure, which incorporates a pyrrole and pyridine moiety. This compound typically exhibits a molecular formula that reflects its complex arrangement of carbon, hydrogen, and nitrogen atoms. It is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the ethanone functional group suggests that it may participate in various chemical reactions, including acylation and condensation. Additionally, the compound's aromatic rings contribute to its stability and influence its solubility and reactivity in different solvents. Its structural features may also allow for interactions with biological targets, which is crucial for its application in pharmacology. Overall, 1-(1H-pyrrolo[2,3-c]pyridin-3-yl)ethanone represents a fascinating subject for research due to its structural complexity and potential therapeutic implications.

Formula:C₉H₈N₂O

InChI:InChI=1/C9H8N2O/c1-6(12)8-4-11-9-5-10-3-2-7(8)9/h2-5,11H,1H3

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1-(1H-Pyrrolo[2,3-c]pyridin-3-yl)ethanone REF: IN-DA006MKUCAS: 67058-71-3	98%	To inquire	Mon 21 Apr 25
1-(1H-Pyrrolo[2,3-c]pyridin-3-yl)ethanone REF: 54-OR94581CAS: 67058-71-3	95%	109.00 €~730.00 €	Tue 22 Apr 25
1-(1H-Pyrrolo[2,3-c]pyridin-3-yl)ethanone REF: 10-F219268CAS: 67058-71-3	95.0%	43.00 €~338.00 €	Tue 22 Apr 25
1-(1H-Pyrrolo[2,3-c]pyridin-3-yl)ethanone REF: 3D-SCA05871CAS: 67058-71-3	Min. 95%	- - -	Discontinued product