CymitQuimica logo

CAS 67058-76-8

:

3-bromo-1H-pyrrolo[2,3-c]pyridine

Description:
3-Bromo-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 3-position of the pyrrole ring enhances its reactivity, making it a valuable intermediate in organic synthesis and medicinal chemistry. This compound typically exhibits a pale yellow to brown solid appearance and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dichloromethane. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug discovery and development. The compound may also display interesting electronic properties due to the conjugated system formed by the fused rings. Additionally, it is important to handle this substance with care, as halogenated compounds can pose environmental and health risks. Overall, 3-bromo-1H-pyrrolo[2,3-c]pyridine is a significant compound in the field of organic chemistry, particularly for its applications in synthesizing more complex molecules.
Formula:C7H5BrN2
InChI:InChI=1/C7H5BrN2/c8-6-3-10-7-4-9-2-1-5(6)7/h1-4,10H
InChI key:DAGAQTLMZAEUKX-UHFFFAOYSA-N
SMILES:c1cncc2c1c(c[nH]2)Br
Synonyms:
  • 1H-Pyrrolo[2,3-c]pyridine, 3-bromo-
Found 5 products.