CAS 67071-94-7
:10,12-Heptacosadiynoic acid
Description:
10,12-Heptacosadiynoic acid, also known by its CAS number 67071-94-7, is a long-chain fatty acid characterized by the presence of two conjugated triple bonds in its carbon chain, specifically located at the 10th and 12th carbon positions. This unique structure contributes to its distinct physical and chemical properties, including a relatively high melting point compared to saturated fatty acids of similar chain length. It is typically found in certain natural sources, such as specific plant oils and microbial metabolites. The presence of the triple bonds imparts significant reactivity, making it a candidate for various chemical transformations and applications in materials science, particularly in the development of polymers and nanomaterials. Additionally, its amphiphilic nature allows it to interact with both hydrophilic and hydrophobic environments, which can be advantageous in biological and industrial applications. Overall, 10,12-Heptacosadiynoic acid is of interest in both research and potential applications due to its unique structural features and reactivity.
Formula:C27H46O2
InChI:InChI=1/C27H46O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27(28)29/h2-14,19-26H2,1H3,(H,28,29)
SMILES:CCCCCCCCCCCCCCC#CC#CCCCCCCCCC(=O)O
Synonyms:- Heptacosa-10,12-Diynoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
10,12-Heptacosadiynoic Acid
CAS:Formula:C27H46O2Purity:>98.0%(GC)Color and Shape:White to Gray to Dark blue powder to crystalMolecular weight:402.6610,12-Heptacosadiynoic Acid
CAS:10,12-Heptacosadiynoic Acid is a ferrite that can be used as a monomer for the synthesis of magnetic nanoparticles. It has been shown to have an antiproliferative effect on cancer cells and can be used in the diagnosis of various cancers. 10,12-Heptacosadiynoic Acid is also able to interact with optical properties. This property makes it possible to use 10,12-Heptacosadiynoic Acid to detect water on surfaces by introducing a small amount of this compound into the water and looking for any changes in the optical properties.Formula:C27H46O2Purity:Min. 95%Color and Shape:PowderMolecular weight:402.65 g/mol




