CymitQuimica logo

CAS 67102-87-8

:

Pentomone

Description:
Pentomone, identified by the CAS number 67102-87-8, is a chemical compound that belongs to the class of organic substances. It is characterized by its unique molecular structure, which typically includes multiple functional groups that contribute to its chemical reactivity and properties. Pentomone is often studied for its potential applications in various fields, including pharmaceuticals and materials science. Its physical properties, such as solubility, boiling point, and melting point, can vary based on its specific formulation and purity. Additionally, Pentomone may exhibit specific biological activities, making it of interest in medicinal chemistry. Safety data sheets and regulatory information should be consulted for handling and usage guidelines, as with any chemical substance. Overall, Pentomone represents a compound with diverse potential applications, warranting further investigation into its properties and uses in scientific research and industry.
Formula:C24H26O5
InChI:InChI=1/C24H26O5/c1-24(2)22-15(11-13-7-5-9-17(26-3)20(13)28-22)19(25)16-12-14-8-6-10-18(27-4)21(14)29-23(16)24/h5-10,15-16,22-23H,11-12H2,1-4H3/t15-,16+,22-,23+
Synonyms:
  • Pentomone [USAN:INN]
  • (5aR,6aS,12aR,13aS)-4,8-dimethoxy-6,6-dimethyl-6,6a,12,12a,13a,14-hexahydro-5aH,13H-chromeno[3,2-b]xanthen-13-one
  • 5aH,13H-(1)Benzopyrano(3,2-b)xanthen-13-one, 6,6a,12,12a,13a,14-hexahydro-4,8-dimethoxy-6,6-dimethyl-, (5aalpha,6aalpha,12aalpha,13aalpha)-
  • 6,6aalpha,12,12aalpha,13aalpha,14-Hexahydro-4,8-dimethoxy-6,6-dimethyl-5aalphaH,13H-(1)benzopyrano(3,2-b)xanthen-13-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.