CAS 67103-05-3
:(Perfluorododecyl)ethylene
Description:
(Perfluorododecyl)ethylene, with the CAS number 67103-05-3, is a fluorinated organic compound characterized by a long perfluorinated carbon chain and an ethylene moiety. This substance is part of a class of compounds known as perfluorinated compounds (PFCs), which are recognized for their unique properties, including high thermal stability, chemical inertness, and low surface tension. These characteristics make (Perfluorododecyl)ethylene useful in various applications, particularly in the fields of coatings, surfactants, and as additives in various industrial processes. The presence of fluorine atoms contributes to its hydrophobic and oleophobic properties, making it effective in repelling water and oils. However, like many perfluorinated compounds, it raises environmental and health concerns due to its persistence in the environment and potential bioaccumulation. Regulatory scrutiny is increasing around such substances, prompting research into safer alternatives and the development of methods for their degradation and removal from the environment.
Formula:C14H3F25
InChI:InChI=1/C14H3F25/c1-2-3(15,16)4(17,18)5(19,20)6(21,22)7(23,24)8(25,26)9(27,28)10(29,30)11(31,32)12(33,34)13(35,36)14(37,38)39/h2H,1H2
SMILES:C=CC(C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Synonyms:- 1H,1H,2H-Perfluoro-1-tetradecene
- 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-Pentacosafluorotetradec-1-Ene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1H,1H,2H-Pentacosafluorotetradec-1-ene
CAS:1H,1H,2H-Pentacosafluorotetradec-1-eneFormula:C14H3F25Purity:97%Color and Shape: solidMolecular weight:646.13g/mol(Perfluorododecyl)ethylene
CAS:(Perfluorododecyl)ethylene is a chemical that is used to extract volatile organic compounds from air samples. It has been shown to be an effective solvent for the extraction of substances from air samples, with low concentrations required for detection. This chemical can be used in analytical methods, such as quantification and research, or in environmental strategies. The inherent properties of (perfluorododecyl)ethylene make it suitable for use in a variety of different applications.
Formula:C14H3F25Purity:Min. 95%Molecular weight:646.13 g/mol

