CAS 67118-32-5
:2-(2-oxopyrrolidin-1-yl)propanoic acid
Description:
2-(2-Oxopyrrolidin-1-yl)propanoic acid, also known by its CAS number 67118-32-5, is a chemical compound characterized by its unique structure that includes a pyrrolidine ring and a propanoic acid moiety. This compound features a ketone functional group within the pyrrolidine ring, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid at room temperature and is soluble in polar solvents, which may facilitate its use in various chemical reactions and applications. The presence of both the pyrrolidine and carboxylic acid functionalities suggests that it may exhibit properties such as hydrogen bonding and potential interactions with biological systems. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting neurological or metabolic pathways, due to its structural similarities to other biologically active molecules. As with many organic compounds, safety and handling precautions should be observed, as its specific toxicity and environmental impact would depend on concentration and exposure.
Formula:C7H11NO3
InChI:InChI=1/C7H11NO3/c1-5(7(10)11)8-4-2-3-6(8)9/h5H,2-4H2,1H3,(H,10,11)
InChI key:InChIKey=SDWWBSPLLLYOJH-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C)N1C(=O)CCC1
Synonyms:- 1-Pyrrolidineacetic acid, alpha-methyl-2-oxo-
- 1-Pyrrolidineacetic acid, α-methyl-2-oxo-
- α-Methyl-2-oxo-1-pyrrolidineacetic acid
- 2-(2-Oxopyrrolidin-1-yl)propanoic acid
- 2-(2-Oxopyrrolidin-1-yl)propanoic acid
- 1-Pyrrolidinepropanoic acid, 2-oxo-
- 2-Oxo-1-pyrrolidinepropionic acid
- 2-(2-ketopyrrolidin-1-yl)propionic acid
- 2-(2-oxopyrrolidin-1-yl)propanoic acid(SALTDATA: FREE)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(2-Oxopyrrolidin-1-yl)propanoic Acid
CAS:Controlled ProductFormula:C7H11NO3Color and Shape:NeatMolecular weight:157.167
