CAS 67118-34-7
:(2-oxo-4-phenylpyrrolidin-1-yl)acetic acid
Description:
(2-Oxo-4-phenylpyrrolidin-1-yl)acetic acid, with the CAS number 67118-34-7, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered cyclic amine. This compound features a ketone group (2-oxo) and a phenyl group (4-phenyl) attached to the pyrrolidine, contributing to its unique reactivity and properties. The presence of the acetic acid moiety indicates that it has both acidic and basic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. Additionally, the compound may exhibit specific solubility characteristics, influencing its behavior in different solvents. Overall, (2-oxo-4-phenylpyrrolidin-1-yl)acetic acid is a versatile compound with potential implications in both synthetic and medicinal chemistry.
Formula:C12H13NO3
InChI:InChI=1/C12H13NO3/c14-11-6-10(7-13(11)8-12(15)16)9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,15,16)
SMILES:c1ccc(cc1)C1CC(=O)N(C1)CC(=O)O
Synonyms:- 1-Pyrrolidineacetic acid, 2-oxo-4-phenyl-
- (2-Oxo-4-phenylpyrrolidin-1-yl)acetic acid
- CHEMBRDG-BB 4400190
- 2-(2-oxo-4-phenylpyrrolidin-1-yl)acetic acid
- 2-(2-oxo-4-phenyl-1-pyrrolidinyl)acetic acid
- Albb-009355
- (2-oxo-4-phenylpyrrolidin-1-yl)acetic acid(SALTDATA: FREE)
- (2-Oxo-4-phenyl-1-pyrrolidinyl)acetic acid
- 2-(2-oxo-4-phenyl-pyrrolidin-1-yl)ethanoic acid
- 2-(2-keto-4-phenyl-pyrrolidin-1-yl)acetic acid
- 2-(2-oxo-4-phenyl-pyrrolidin-1-yl)acetic acid
- 2-Oxo-4-phenyl-3-pyrrolidinecarboxylic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2-oxo-4-phenylpyrrolidin-1-yl)acetic acid
CAS:Formula:C12H13NO3Color and Shape:SolidMolecular weight:219.2365(2-oxo-4-phenylpyrrolidin-1-yl)acetic Acid
CAS:Applications (2-oxo-4-phenylpyrrolidin-1-yl)acetic Acid (cas# 67118-34-7) is a useful research chemical.
Formula:C12H13NO3Color and Shape:NeatMolecular weight:219.24(2-Oxo-4-phenylpyrrolidin-1-yl)acetic acid
CAS:Phenotropil is a nootropic drug that belongs to the group of aromatic amines. It is a high-activity, active compound with optical activity and an analyzed structure. Phenotropil has been shown to be safe and effective in the treatment of overweight patients with mild cognitive impairment (MCI). Phenotropil has also been used as an adjuvant therapy for brain trauma and cerebrovascular diseases. The most common side effects are nausea, vomiting, diarrhea, dizziness, headache, agitation, drowsiness, insomnia, depression, and hallucinations. Phenotropol can exist as two optical isomers: R-(+)-phenylpiracetam and S-(-)-phenylpiracetam. These optical isomers have different pharmacological properties.Formula:C12H13NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:219.24 g/mol(2-Oxo-4-phenyl-pyrrolidin-1-yl)acetic acid
CAS:Formula:C12H13NO3Purity:95.0%Color and Shape:SolidMolecular weight:219.24



