CAS 6712-12-5
:hexahydro-2H-3,5-methanocyclopenta[b]furan-2-one
Description:
Hexahydro-2H-3,5-methanocyclopenta[b]furan-2-one, with the CAS number 6712-12-5, is a cyclic organic compound characterized by its unique fused ring structure. It belongs to the class of compounds known as lactones, specifically a saturated derivative of a furan. This compound typically exhibits a pleasant, sweet odor, making it of interest in the fragrance and flavor industries. Its molecular structure contributes to its stability and reactivity, allowing it to participate in various chemical reactions, including those involving nucleophiles and electrophiles. Hexahydro-2H-3,5-methanocyclopenta[b]furan-2-one is soluble in organic solvents and has limited solubility in water, which is common for many cyclic compounds. Due to its structural features, it may also exhibit biological activity, although specific biological properties would require further investigation. Overall, this compound's unique characteristics make it a subject of interest in both synthetic chemistry and applications in consumer products.
Formula:C8H10O2
InChI:InChI=1/C8H10O2/c9-8-6-2-4-1-5(6)7(3-4)10-8/h4-7H,1-3H2
SMILES:C1C2CC3C1C(C2)OC3=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.