CAS 6713-27-5
:Moronic acid
Description:
Moronic acid is a triterpenoid compound primarily derived from various plant sources, particularly from the family of the Euphorbiaceae. It is characterized by its pentacyclic structure, which is typical of many triterpenes. Moronic acid exhibits a range of biological activities, including anti-inflammatory, antimicrobial, and potential anticancer properties, making it of interest in pharmacological research. The compound is typically found in the form of a white crystalline solid and is soluble in organic solvents but has limited solubility in water. Its molecular structure includes multiple functional groups, contributing to its reactivity and interaction with biological systems. Moronic acid is also studied for its potential applications in natural product synthesis and as a lead compound in drug development. Overall, its unique structural features and biological significance make it a subject of interest in both organic chemistry and medicinal research.
Formula:C30H46O3
InChI:InChI=1/C30H46O3/c1-25(2)14-16-30(24(32)33)17-15-28(6)19(20(30)18-25)8-9-22-27(5)12-11-23(31)26(3,4)21(27)10-13-29(22,28)7/h18-19,21-22H,8-17H2,1-7H3,(H,32,33)/t19-,21+,22-,27+,28-,29-,30+/m1/s1
InChI key:InChIKey=UMYJVVZWBKIXQQ-QALSDZMNSA-N
SMILES:C[C@]12[C@@]3(C)[C@@](C=4[C@@](C(O)=O)(CC3)CCC(C)(C)C4)(CC[C@@]1([C@]5(C)[C@@](CC2)(C(C)(C)C(=O)CC5)[H])[H])[H]
Synonyms:- (+)-Moronic acid
- Ambronic acid
- Olean-18-En-28-Oic Acid, 3-Oxo-
- 3-Oxoolean-18-en-28-oic acid
- 3-Oxooleana-18-ene-28-oic acid
- moronicaci
- 3-Oxo-5α-olean-18-en-28-oic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Moronic acid
CAS:<p>Moronic acid shows oral therapeutic efficacy in HSV-infected mice and possessed novel anti-HSV activity.</p>Formula:C30H46O3Purity:98%Color and Shape:SolidMolecular weight:454.68Moronic Acid
CAS:Formula:C30H46O3Purity:>96.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:454.70Moronic Acid
CAS:Controlled Product<p>Moronic acid is a fatty acid found in the seeds of Morus alba. It has been shown to have anti-infective properties by binding to the bacterial efflux protein, which is responsible for transporting toxic compounds out of the cell. The binding of moronic acid to the efflux protein prevents it from functioning and leads to increased expression of proinflammatory genes, ultimately leading to cell death. Moronic acid has also been shown to bind to a receptor on Staphylococcus aureus that is responsible for regulating virulence factors, leading to decreased production of proteins such as coagulase and proteases. Moronic acid also binds with oleanolic acid and inhibits the growth of Mycobacterium tuberculosis in vitro.</p>Formula:C30H46O3Purity:Min. 95%Color and Shape:PowderMolecular weight:454.68 g/mol
