CAS 67139-79-1

4,6-dichloro-1H-pyrrolo[3,2-c]pyridine

Description:

4,6-Dichloro-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features two chlorine substituents at the 4 and 6 positions of the pyrrolo ring, enhancing its reactivity and potential applications in various chemical reactions. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of chlorine atoms can influence its electronic properties, making it a candidate for use in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the compound may exhibit biological activity, which warrants further investigation for potential therapeutic applications. Safety data should be consulted to understand its handling and toxicity, as halogenated compounds can pose environmental and health risks. Overall, 4,6-dichloro-1H-pyrrolo[3,2-c]pyridine is of interest in both academic and industrial chemistry due to its structural features and potential utility.

Formula: C₇H₄Cl₂N₂

InChI: InChI=1/C7H4Cl2N2/c8-6-3-5-4(1-2-10-5)7(9)11-6/h1-3,10H

SMILES: c1c[nH]c2cc(Cl)nc(c12)Cl

Synonyms:

• 1H-pyrrolo[3,2-c]pyridine, 4,6-dichloro-
• 4,6-dichloro-1H-pyrrolo-[3,2-C]-pyridine

4,6-dichloro-1H-pyrrolo[3,2-c]pyridine

CAS: 67139-79-1

Formula: C₇H₄Cl₂N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 187.0261

Ref: IN-DA0036QM

4,6-Dichloro-1H-pyrrolo[3,2-c]pyridine

CAS: 67139-79-1

4,6-Dichloro-1H-pyrrolo[3,2-c]pyridine

Purity: 97%

Color and Shape: Solid

Molecular weight: 187.02606g/mol

Ref: 54-OR302339

4,6-Dichloro-1H-pyrrolo[3,2-c]pyridine

CAS: 67139-79-1

Formula: C₇H₄Cl₂N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 187.02

Ref: 10-F076927