CAS 6715-89-5

1H-Pyrazole-1-acetic acid, 4-iodo-3,5-dimethyl-, sodium salt (1:1)

Description:

1H-Pyrazole-1-acetic acid, 4-iodo-3,5-dimethyl-, sodium salt (1:1), with CAS number 6715-89-5, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an acetic acid functional group, contributing to its acidic properties, and the presence of iodine and methyl groups enhances its reactivity and potential biological activity. As a sodium salt, it is typically more soluble in water compared to its acid form, which can facilitate its use in various applications, including pharmaceuticals and agrochemicals. The compound may exhibit specific pharmacological properties due to its structural features, making it of interest in medicinal chemistry. Additionally, the presence of halogen atoms, such as iodine, can influence the compound's stability and reactivity, potentially affecting its interactions in biological systems. Overall, this compound's unique structure and properties make it a subject of interest for further research and application in various fields.

Formula: C₇H₉IN₂O₂·Na

InChI: InChI=1S/C7H9IN2O2.Na/c1-4-7(8)5(2)10(9-4)3-6(11)12;/h3H2,1-2H3,(H,11,12);

InChI key: InChIKey=XKBZWANXENCZTO-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1C(C)=C(I)C(C)=N1.[Na]

Synonyms:

• Pyrazole-1-acetic acid, 4-iodo-3,5-dimethyl-, sodium salt
• 1H-Pyrazole-1-acetic acid, 4-iodo-3,5-dimethyl-, sodium salt (1:1)