CAS 67152-20-9
:2,4-difluoro-5-nitrobenzonitrile
Description:
2,4-Difluoro-5-nitrobenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two fluorine atoms, a nitro group, and a cyano group. The presence of the difluoro and nitro substituents contributes to its unique chemical properties, including increased reactivity and potential applications in various chemical syntheses. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests that it may participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the nitro and cyano groups, which can influence the reactivity of the aromatic ring. Additionally, the fluorine atoms can enhance the compound's stability and alter its electronic properties. 2,4-Difluoro-5-nitrobenzonitrile may be used in the synthesis of pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, highlighting its significance in both industrial and research applications. Safety precautions should be taken when handling this compound, as it may pose health hazards.
Formula:C7H2F2N2O2
InChI:InChI=1/C7H2F2N2O2/c8-5-2-6(9)7(11(12)13)1-4(5)3-10/h1-2H
SMILES:c1c(C#N)c(cc(c1N(=O)=O)F)F
Synonyms:- Benzonitrile, 2,4-Difluoro-5-Nitro-
- Wnr Bf Df Ecn [Wln]
- 2,4-Difluoro-5-ntirobenzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,4-Difluoro-5-nitrobenzonitrile
CAS:Formula:C7H2F2N2O2Purity:98%Color and Shape:SolidMolecular weight:184.09982,4-Difluoro-5-nitrobenzonitrile
CAS:2,4-Difluoro-5-nitrobenzonitrilePurity:98%Color and Shape:SolidMolecular weight:184.10g/mol2,4-Difluoro-5-nitrobenzonitrile
CAS:Formula:C7H2F2N2O2Purity:98%Color and Shape:SolidMolecular weight:184.1022,4-Difluoro-5-nitrobenzonitrile
CAS:<p>2,4-Difluoro-5-nitrobenzonitrile is a chemical that has been found to have affinity for the central nervous system. It inhibits the reuptake of monoamines such as dopamine and serotonin. This chemical has been shown to be endogenously produced in humans and animals. 2,4-Difluoro-5-nitrobenzonitrile also inhibits the uptake of amines by blocking the activity of their respective transporters. The compound is an isomeric mixture of two possible structures, which differ in their position on the benzene ring. The first form is characterized by a low affinity for neurotransmitter receptors and therefore has low inhibitory properties on monoamine uptake. The second form has greater affinity for neurotransmitter receptors and therefore has greater inhibitory properties on monoamine uptake, although at higher concentrations it may lead to adverse effects on muscle tissue.</p>Formula:C7H2F2N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:184.1 g/mol



