CAS 67160-74-1
:4-[1-Hydroxy-2-[(1-methyl-2-phenoxyethyl)amino]propyl]phenyl 2,2-dimethylpropanoate
Description:
4-[1-Hydroxy-2-[(1-methyl-2-phenoxyethyl)amino]propyl]phenyl 2,2-dimethylpropanoate, with the CAS number 67160-74-1, is a chemical compound that belongs to the class of esters and amines. This substance features a complex molecular structure characterized by a phenyl group, a hydroxy group, and an amino group, which contribute to its potential biological activity. The presence of the dimethylpropanoate moiety suggests it may exhibit lipophilic properties, enhancing its solubility in organic solvents. The compound is likely to be involved in various chemical reactions due to its functional groups, making it of interest in medicinal chemistry and pharmaceutical applications. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C23H31NO4
InChI:InChI=1S/C23H31NO4/c1-16(15-27-19-9-7-6-8-10-19)24-17(2)21(25)18-11-13-20(14-12-18)28-22(26)23(3,4)5/h6-14,16-17,21,24-25H,15H2,1-5H3
InChI key:InChIKey=QAYOFBVPJIPEAO-UHFFFAOYSA-N
SMILES:C(C(NC(COC1=CC=CC=C1)C)C)(O)C2=CC=C(OC(C(C)(C)C)=O)C=C2
Synonyms:- 4-(1-Hydroxy-2-((1-methyl-2-phenoxyethyl)amino)propyl)phenyl (2,2-dimethyl)propanoate
- 4-[1-Hydroxy-2-[(1-methyl-2-phenoxyethyl)amino]propyl]phenyl 2,2-dimethylpropanoate
- 4-{1-Hydroxy-2-[(1-Phenoxypropan-2-Yl)Amino]Propyl}Phenyl 2,2-Dimethylpropanoate
- Benzyl alcohol, p-hydroxy-alpha-(1-((1-methyl-2-phenoxyethyl)amino)ethyl)-, pivalate
- Brn 2769574
- Lr693
- Propanoic acid, 2,2-dimethyl-, 4-[1-hydroxy-2-[(1-methyl-2-phenoxyethyl)amino]propyl]phenyl ester
- p-Hydroxy-alpha-(1-((1-methyl-2-phenoxyethyl)amino)ethyl)benzyl alcohol pivalate
- 4-(1-Hydroxy-2-((1-methyl-2-phenoxyethyl)amino)propyl)phenyl pivalate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-[1-Hydroxy-2-[(1-methyl-2-phenoxyethyl)amino]propyl]phenyl pivalate
CAS:4-[1-Hydroxy-2-[(1-methyl-2-phenoxyethyl)amino]propyl]phenyl pivalate is an inhibitor of protein interactions that belongs to the group of peptides. The inhibition profile of this compound has been characterized by a number of different techniques, including fluorescence resonance energy transfer (FRET), surface plasmon resonance, and antibody labeling. 4-[1-Hydroxy-2-[(1-methyl-2-phenoxyethyl)amino]propyl]phenyl pivalate can be used as a research tool for studying receptor activation and ligand binding. It also serves as an immunological reagent for detecting the presence of specific proteins in cell culture.Formula:C23H31NO4Purity:Min. 95%Molecular weight:385.5 g/molIsoxsuprine-monoester-1
CAS:Isoxsuprine-monoester-1 is a monoester of isoxsuprine,and is a long acting peripheral vasodilator.Formula:C23H31NO4Purity:98%Color and Shape:SolidMolecular weight:385.5

