CymitQuimica logo

CAS 67175-28-4

:

3-Hydroxy-2,6-dinitrobenzoic acid

Description:
3-Hydroxy-2,6-dinitrobenzoic acid, with the CAS number 67175-28-4, is an organic compound characterized by the presence of both hydroxyl and nitro functional groups attached to a benzoic acid structure. This compound typically appears as a yellow to orange crystalline solid. The hydroxyl group (-OH) contributes to its acidity, while the dinitro groups (-NO2) enhance its reactivity and can influence its solubility in various solvents. The presence of multiple nitro groups often imparts explosive properties, making such compounds of interest in both chemical synthesis and materials science. Additionally, 3-hydroxy-2,6-dinitrobenzoic acid may exhibit biological activity, which can be explored for potential applications in pharmaceuticals or agrochemicals. Its synthesis usually involves nitration reactions followed by hydrolysis, and it is important to handle this compound with care due to its potential hazards. Overall, this compound serves as a valuable intermediate in organic synthesis and research.
Formula:C7H4N2O7
InChI:InChI=1S/C7H4N2O7/c10-4-2-1-3(8(13)14)5(7(11)12)6(4)9(15)16/h1-2,10H,(H,11,12)
InChI key:InChIKey=AHGWZSUEMUEPEF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N(=O)=O)C(O)=CC=C1N(=O)=O
Synonyms:
  • 3-Hydroxy-2,6-dinitrobenzoic acid
  • Benzoic acid, 3-hydroxy-2,6-dinitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.