CymitQuimica logo

CAS 67191-35-9

:

Benzene, 1-ethenyl-2-(1-methylethoxy)-

Description:
Benzene, 1-ethenyl-2-(1-methylethoxy)-, also known by its CAS number 67191-35-9, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an ethenyl group and a 1-methylethoxy group. This compound exhibits typical properties of aromatic hydrocarbons, such as stability and a distinct, sweet odor. The presence of the ethenyl group introduces unsaturation, which can influence its reactivity, particularly in addition reactions. The 1-methylethoxy substituent contributes to the compound's hydrophobic characteristics, affecting its solubility in various solvents. Additionally, the compound may participate in electrophilic aromatic substitution reactions due to the electron-donating nature of the substituents. Its applications can range from use in organic synthesis to potential roles in materials science, depending on its reactivity and stability under different conditions. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if not managed properly.
Formula:C11H14O
InChI:InChI=1S/C11H14O/c1-4-10-7-5-6-8-11(10)12-9(2)3/h4-9H,1H2,2-3H3
InChI key:SXCKVSZTZAMSRS-UHFFFAOYSA-N
SMILES:CC(C)OC1=CC=CC=C1C=C
Found 4 products.