CAS 67193-97-9

2H-1,4-Benzoxazin-3(4H)-one, 7-hydroxy-

Description:

2H-1,4-Benzoxazin-3(4H)-one, 7-hydroxy- is a chemical compound characterized by its heterocyclic structure, which includes a benzene ring fused to a benzoxazine moiety. This compound features a hydroxyl group at the 7-position, contributing to its potential reactivity and solubility properties. It is known for its role in various biological activities, including potential antioxidant and anti-inflammatory effects. The presence of the hydroxyl group enhances its ability to participate in hydrogen bonding, which can influence its interactions with other molecules. This compound is often studied in the context of natural products and may be derived from plant sources, particularly in the context of phytochemistry. Its CAS number, 67193-97-9, allows for easy identification in chemical databases. Overall, 2H-1,4-Benzoxazin-3(4H)-one, 7-hydroxy- is of interest in both synthetic and medicinal chemistry due to its unique structural features and potential applications.

Formula: C₈H₇NO₃

InChI: InChI=1S/C8H7NO3/c10-5-1-2-6-7(3-5)12-4-8(11)9-6/h1-3,10H,4H2,(H,9,11)

SMILES: c1cc2c(cc1O)OCC(=N2)O

Synonyms:

• 7-Hydroxy-2H-Benzo[B][1,4]Oxazin-3(4H)-One

7-hydroxy-2H-benzo[b][1,4]oxazin-3(4H)-one

CAS: 67193-97-9

Formula: C₈H₇NO₃

Purity: %

Color and Shape: Solid

Molecular weight: 165.1461

Ref: IN-DA00FGBE

7-Hydroxy-2H-benzo[b][1,4]oxazin-3(4H)-one

CAS: 67193-97-9

7-Hydroxy-2H-benzo[b][1,4]oxazin-3(4H)-one

Purity: 95%

Molecular weight: 165.15g/mol

Ref: 54-OR1064718

7-Hydroxy-2H-benzo[b][1,4]oxazin-3(4H)-one

CAS: 67193-97-9

Versatile small molecule scaffold

Formula: C₈H₇NO₃

Purity: Min. 95%

Molecular weight: 165.15 g/mol

Ref: 3D-SCA19397