CAS 67197-53-9

(2,6-Dibromophenyl)acetonitrile

Description:

(2,6-Dibromophenyl)acetonitrile is an organic compound characterized by its structure, which features a phenyl ring substituted with two bromine atoms at the 2 and 6 positions, along with an acetonitrile functional group. This compound typically appears as a colorless to pale yellow solid or liquid, depending on its purity and form. It is known for its moderate solubility in organic solvents such as ethanol and acetone, while being less soluble in water. The presence of bromine atoms contributes to its reactivity, making it useful in various chemical synthesis applications, particularly in the field of pharmaceuticals and agrochemicals. The acetonitrile group imparts polar characteristics, which can influence its interactions in chemical reactions. Safety considerations include handling it with care due to potential toxicity and environmental impact, as brominated compounds can pose risks. Overall, (2,6-Dibromophenyl)acetonitrile is a valuable compound in synthetic organic chemistry, with applications that leverage its unique structural features.

Formula: C₈H₅Br₂N

InChI: InChI=1/C8H5Br2N/c9-7-2-1-3-8(10)6(7)4-5-11/h1-3H,4H2

SMILES: c1cc(c(CC#N)c(c1)Br)Br

Synonyms:

• Benzeneacetonitrile, 2,6-dibromo-
• 2,6-Dibromo-Benzeneacetonitrile

2-(2,6-Dibromophenyl)acetonitrile

CAS: 67197-53-9

Formula: C₈H₅Br₂N

Purity: 95%

Color and Shape: Solid

Molecular weight: 274.9400

Ref: IN-DA00FFCG

2-(2,6-Dibromophenyl)acetonitrile

CAS: 67197-53-9

2-(2,6-Dibromophenyl)acetonitrile

Purity: 98%

Molecular weight: 274.943g/mol

Ref: 54-OR75312

2-(2,6-Dibromophenyl)acetonitrile

CAS: 67197-53-9

Formula: C₈H₅Br₂N

Purity: 95%

Color and Shape: Solid

Molecular weight: 274.943

Ref: 10-F238136