CAS 672-45-7
:6-(Trifluoromethyl)uracil
Description:
6-(Trifluoromethyl)uracil is a fluorinated derivative of uracil, a pyrimidine nucleobase that is a component of RNA. This compound features a trifluoromethyl group (-CF3) at the 6-position of the uracil ring, which significantly influences its chemical properties and biological activity. The presence of the trifluoromethyl group enhances lipophilicity and can affect the compound's interaction with biological targets, potentially leading to increased potency or altered pharmacokinetics. 6-(Trifluoromethyl)uracil exhibits characteristics typical of uracil derivatives, including the ability to participate in hydrogen bonding due to its keto and amino functional groups. It may also exhibit unique reactivity due to the electronegative fluorine atoms, which can stabilize certain intermediates or influence reaction pathways. This compound is of interest in medicinal chemistry and research, particularly in the development of antiviral agents and cancer therapeutics, as modifications to nucleobases can lead to novel mechanisms of action. Its CAS number, 672-45-7, is used for identification in chemical databases and regulatory contexts.
Formula:C5H3F3N2O2
InChI:InChI=1/C5H3F3N2O2/c6-5(7,8)2-1-3(11)10-4(12)9-2/h1H,(H2,9,10,11,12)
SMILES:c1c(C(F)(F)F)nc(nc1O)O
Synonyms:- 6-(trifluoromethyl)pyrimidine-2,4(1H,3H)-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-(Trifluoromethyl)pyrimidine-2,4-diol
CAS:Formula:C5H3F3N2O2Purity:98%Color and Shape:SolidMolecular weight:180.08476-(Trifluoromethyl)uracil
CAS:Formula:C5H3F3N2O2Purity:98%Color and Shape:Solid, PowderMolecular weight:180.0866-(Trifluoromethyl)uracil
CAS:6-(Trifluoromethyl)uracil is a synthetic analog of uracil, which is a nucleobase that is found in RNA. It can be synthesized by reacting phosphorus oxychloride and trifluoromethyl chloride to form the corresponding chloroformate ester, followed by hydrolysis with anhydrous potassium carbonate. The compound has been shown to inhibit bacterial growth in bioassays and also has the ability to react with amines. 6-Trifluoromethyluracil has a constant chlorine atom that forms hydrogen bonds with other molecules, such as ammonia or amines, which may have antibacterial properties.Formula:C5H3F3N2O2Purity:Min. 95%Molecular weight:180.08 g/mol



