CAS 672-67-3
:2-Oxo-2H-pyran-6-carboxylic acid
Description:
2-Oxo-2H-pyran-6-carboxylic acid, also known as 6-carboxy-2-pyrone, is a heterocyclic organic compound characterized by a pyran ring with a carboxylic acid functional group and a ketone group. This compound typically appears as a white to light yellow crystalline solid and is soluble in polar solvents such as water and alcohols. Its molecular structure features a six-membered ring containing one oxygen atom and is known for its ability to participate in various chemical reactions, including condensation and cyclization. The presence of both the carboxylic acid and ketone groups allows for diverse reactivity, making it useful in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, 2-oxo-2H-pyran-6-carboxylic acid exhibits potential biological activities, including antimicrobial and antioxidant properties, which have garnered interest in medicinal chemistry. Safety data indicates that, like many organic compounds, it should be handled with care to avoid potential health hazards.
Formula:C6H4O4
InChI:InChI=1/C6H4O4/c7-5-3-1-2-4(10-5)6(8)9/h1-3H,(H,8,9)
InChI key:InChIKey=AUZCNXBFVCKKHV-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1OC(=O)C=CC1
Synonyms:- 2,4-Hexadienedioic acid, 2-hydroxy-, δ-lactone
- 2-Pyranone-6-carboxylic acid
- 2-Pyrone-6-carboxylic acid
- 2H-Pyran-2-one-6-carboxylic acid
- 2H-pyran-6-carboxylic acid, 2-oxo-
- NSC 35012
- NSC 403109
- 2-Oxo-2H-pyran-6-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Oxo-2H-pyran-6-carboxylic acid
CAS:<p>2-Oxo-2H-pyran-6-carboxylic acid is a diphenyl ether that is used as an antimicrobial preservative. It functions by inhibiting bacterial growth and the activity of enzymes, such as pyrylium, which is required for the synthesis of DNA. 2-Oxo-2H-pyran-6-carboxylic acid has also been shown to bind to biphenyl and ether linkages in bacterial cells, preventing their replication. This compound has an acidic pH (4) and can be synthesized on a solid support using hydrochloric acid as a catalyst at neutral pH. The culture supernatant is then mixed with organic acids, such as acetic acid or formic acid, to produce 2-oxo-2H-pyran-6 carboxylic acid in solution.</p>Formula:C6H4O4Purity:Min. 95%Molecular weight:140.09 g/mol

