CAS 67209-77-2
:2-methylcyclopent-1-ene-1-carboxylic acid
Description:
2-Methylcyclopent-1-ene-1-carboxylic acid is an organic compound characterized by its cyclopentene structure with a carboxylic acid functional group and a methyl substituent. This compound features a five-membered carbon ring with a double bond, which contributes to its reactivity and potential applications in organic synthesis. The presence of the carboxylic acid group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The methyl group enhances the compound's steric properties and can influence its reactivity and solubility in different solvents. Typically, compounds like this may exhibit moderate polarity due to the carboxylic acid, affecting their interactions with other molecules. Additionally, the compound may have applications in the synthesis of more complex organic molecules or as an intermediate in various chemical processes. Its specific physical properties, such as boiling point, melting point, and solubility, would depend on the molecular structure and the presence of functional groups.
Formula:C7H10O2
InChI:InChI=1/C7H10O2/c1-5-3-2-4-6(5)7(8)9/h2-4H2,1H3,(H,8,9)
SMILES:CC1=C(CCC1)C(=O)O
Synonyms:- 1-Cyclopentene-1-Carboxylic Acid, 2-Methyl-
- 2-Methylcyclopent-1-ene-1-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-Methylcyclopent-1-ene-1-carboxylic acid
CAS:2-Methylcyclopent-1-ene-1-carboxylic acid is an efficient synthetic route for the preparation of nitroalkanes. This process proceeds by the reaction of ammonium formate with nitromethane to produce 2-methylcyclopent-1-ene, which is then converted to 2-methylcyclopent-1-ene-1-carboxylic acid with hydrolysis. The allylic rearrangement can be carried out using sodium methoxide in methanol, and the denitration can be carried out using piperidine.Formula:C7H10O2Purity:Min. 95%Molecular weight:126.15 g/mol
