CAS 67217-55-4
:Mono-6-O-(p-toluenesulfonyl)-beta-cyclodextrin
Description:
Mono-6-O-(p-toluenesulfonyl)-beta-cyclodextrin is a modified form of beta-cyclodextrin, a cyclic oligosaccharide composed of seven glucose units. This compound features a p-toluenesulfonyl group attached to the 6-position of the beta-cyclodextrin, enhancing its solubility and reactivity. The introduction of the sulfonyl group increases the hydrophobic character of the molecule, allowing it to form inclusion complexes with various organic compounds, which can be beneficial in drug delivery and formulation applications. The modification also improves the stability and bioavailability of guest molecules. Mono-6-O-(p-toluenesulfonyl)-beta-cyclodextrin is typically used in pharmaceutical and analytical chemistry for its ability to encapsulate drugs, thereby improving their solubility and release profiles. Additionally, it can serve as a chiral selector in chromatography. Its unique structural characteristics and functional properties make it a valuable compound in various chemical and industrial applications.
Formula:C49H76O37S
InChI:InChI=1/C49H76O37S/c1-13-2-4-14(5-3-13)87(70,71)72-12-21-42-28(62)35(69)49(79-21)85-41-20(11-55)77-47(33(67)26(41)60)83-39-18(9-53)75-45(31(65)24(39)58)81-37-16(7-51)73-43(29(63)22(37)56)80-36-15(6-50)74-44(30(64)23(36)57)82-38-17(8-52)76-46(32(66)25(38)59)84-40-19(10-54)78-48(86-42)34(68)27(40)61/h2-5,15-69H,6-12H2,1H3/t15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28-,29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,42-,43-,44-,45-,46-,47-,48-,49-/m1/s1
SMILES:Cc1ccc(cc1)S(=O)(=O)OC[C@@H]1[C@@H]2[C@@H]([C@H]([C@H](O1)O[C@@H]1[C@@H](CO)O[C@@H]([C@@H]([C@H]1O)O)O[C@@H]1[C@@H](CO)O[C@@H]([C@@H]([C@H]1O)O)O[C@@H]1[C@@H](CO)O[C@@H]([C@@H]([C@H]1O)O)O[C@@H]1[C@@H](CO)O[C@@H]([C@@H]([C@H]1O)O)O[C@@H]1[C@@H](CO)O[C@@H]([C@@H]([C@H]1O)O)O[C@@H]1[C@@H](CO)O[C@@H]([C@@H]([C@H]1O)O)O2)O)O
Synonyms:- [(1S,3R,5R,6S,8R,10R,11S,13R,15R,16S,18R,20R,21S,23R,25R,26S,28R,30R,31S,33R,35R,36R,37R,38R,39R,40R,41R,42R,43R,44R,45R,46R,47R,48R,49R)-36,37,38,39,40,41,42,43,44,45,46,47,48,49-Tetradecahydroxy-10,15,20,25,30,35-hexakis(hydroxymethyl)-2,4,7,9,12,14,17,19,22,24,27,29,32,34-tetradecaoxaoctacyclo[31.2.2.23,6
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Mono-6-O-(p-toluenesulfonyl)-β-cyclodextrin
CAS:Formula:C49H76O37SPurity:95%Color and Shape:SolidMolecular weight:1289.17056-Mono-O-(p-toluenesulfonyl)-β-cyclodextrin
CAS:6-Mono-O-(p-toluenesulfonyl)-β-cyclodextrinPurity:98%Mono-6-O-(p-toluenesulfonyl)-β-cyclodextrin
CAS:This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.Formula:C49H76O37SPurity:Min. 85 Area-%Color and Shape:PowderMolecular weight:1,289.17 g/mol



