CAS 67221-50-5

4-amino-1H-pyrazole-5-carboxamide

Description:

4-Amino-1H-pyrazole-5-carboxamide, with the CAS number 67221-50-5, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an amino group (-NH2) and a carboxamide group (-C(=O)NH2) attached to the pyrazole ring, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents due to the presence of the carboxamide functional group. The compound is of interest in medicinal chemistry and agricultural applications, often studied for its potential as a pharmaceutical agent or as a building block in the synthesis of more complex molecules. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions and purity of the substance. As with many nitrogen-containing heterocycles, it may exhibit interesting biological activities, making it a subject of research in various fields.

Formula: C₄H₆N₄O

InChI: InChI=1/C4H6N4O/c5-2-1-7-8-3(2)4(6)9/h1H,5H2,(H2,6,9)(H,7,8)

SMILES: c1c(c(C(=O)N)n[nH]1)N

Synonyms:

• 1H-pyrazole-5-carboxamide, 4-amino-

4-AMINO-1H-PYRAZOLE-5-CARBOXAMIDE

CAS: 67221-50-5

Formula: C₄H₆N₄O

Purity: 97%

Color and Shape: Solid

Molecular weight: 126.1166

Ref: IN-DA006JQO

4-Amino-1H-pyrazole-5-carboxamide

CAS: 67221-50-5

4-Amino-1H-pyrazole-5-carboxamide

Purity: 97%

Color and Shape: Powder

Molecular weight: 126.12g/mol

Ref: 54-OR13272

4-amino-1H-pyrazole-5-carboxamide

CAS: 67221-50-5

Formula: C₄H₆N₄O

Purity: 97%

Molecular weight: 126.119

Ref: 10-F311900