CAS 67226-76-0

Acetic acid, [[(1,1-dimethylethyl)dimethylsilyl]oxy]-,(1,1-dimethylethyl)dimethylsilyl ester

Description:

The chemical substance known as "Acetic acid, [[(1,1-dimethylethyl)dimethylsilyl]oxy]-,(1,1-dimethylethyl)dimethylsilyl ester," with the CAS number 67226-76-0, is an organosilicon compound characterized by the presence of both acetic acid and silyl groups. This compound features a silyl ether structure, where a dimethylsilyl group is attached to the acetic acid moiety, enhancing its stability and reactivity. The presence of the tert-butyl group contributes to its steric bulk, which can influence its chemical behavior and interactions. Typically, such compounds exhibit properties like moderate polarity due to the presence of the carboxylic acid functional group, while the silyl groups can impart hydrophobic characteristics. This combination makes the compound useful in various applications, including as a reagent in organic synthesis and in the formulation of silicone-based materials. Additionally, the compound's stability under various conditions is often enhanced by the silyl groups, making it suitable for use in diverse chemical environments.

Formula: C₁₄H₃₂O₃Si₂

InChI: InChI=1S/C14H32O3Si2/c1-13(2,3)18(7,8)16-11-12(15)17-19(9,10)14(4,5)6/h11H2,1-10H3

InChI key: InChIKey=OKWFJWHUFDQPSE-UHFFFAOYSA-N

SMILES: [Si](C(C)(C)C)(OC(CO[Si](C(C)(C)C)(C)C)=O)(C)C

Synonyms:

• Acetic acid, [[(1,1-dimethylethyl)dimethylsilyl]oxy]-, (1,1-dimethylethyl)dimethylsilyl ester
• Acetic acid, 2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-, (1,1-dimethylethyl)dimethylsilyl ester
• (1,1-Dimethylethyl)dimethylsilyl 2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]acetate

TERT-BUTYLDIMETHYLSILYL 2-(TERT-BUTYLDIMETHYLSILYLOXY)ACETATE

CAS: 67226-76-0

Formula: C₁₄H₃₂O₃Si₂

Purity: 95.0%

Molecular weight: 304.577

Ref: 10-F535483

tert-Butyldimethylsilyl 2-[(tert-butyldimethylsilyl)oxy]acetate

CAS: 67226-76-0

Tert-butyldimethylsilyl 2-[(tert-butyldimethylsilyl)oxy]acetate (TBDSO) is an acetylating agent used to produce tertiary alcohols. TBDSO is a nitro compound that is converted by the body into carbon dioxide and water. TBDSO is not orally bioavailable, but can be administered intravenously or intramuscularly. TBDSO has been shown to inhibit the production of cholesterol in animals and humans. It may be used as a chiral building block for pharmaceutical drugs such as statins. Statins are drugs that lower cholesterol levels by inhibiting HMG-CoA reductase, an enzyme involved in the synthesis of cholesterol from mevalonic acid.

Formula: C₁₄H₃₂O₃Si₂

Purity: Min. 95%

Molecular weight: 304.57 g/mol

Ref: 3D-SCA22676