CAS 672266-20-5

2-[2-(1-methylethyl)-4-(4-methylphenyl)tetrahydro-2H-pyran-4-yl]ethanamine

Description:

The chemical substance known as 2-[2-(1-methylethyl)-4-(4-methylphenyl)tetrahydro-2H-pyran-4-yl]ethanamine, with the CAS number 672266-20-5, is a complex organic compound characterized by its unique molecular structure. It features a tetrahydropyran ring, which contributes to its cyclic nature, and an ethylamine side chain that introduces basic amine functionality. The presence of a branched isopropyl group and a para-substituted methylphenyl moiety indicates potential steric hindrance, which may influence its reactivity and interactions with biological targets. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its solubility and pharmacokinetic profile. Additionally, the structural complexity suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific biological activity, toxicity, and environmental impact would require further investigation through empirical studies.

Formula: C₁₇H₂₇NO

InChI: InChI=1/C17H27NO/c1-13(2)16-12-17(8-10-18,9-11-19-16)15-6-4-14(3)5-7-15/h4-7,13,16H,8-12,18H2,1-3H3

SMILES: CC(C)C1CC(CCN)(CCO1)c1ccc(C)cc1