CAS 672309-92-1

2-Chloro-3-[[(1,1-dimethylethoxy)carbonyl]amino]benzeneacetic acid

Description:

2-Chloro-3-[[(1,1-dimethylethoxy)carbonyl]amino]benzeneacetic acid, with the CAS number 672309-92-1, is a chemical compound characterized by its complex structure, which includes a chloro substituent, an amino group, and an acetic acid moiety. This compound typically exhibits properties associated with both aromatic and aliphatic functionalities, contributing to its potential reactivity and solubility characteristics. The presence of the chloro group can enhance electrophilic reactivity, while the amino group may participate in hydrogen bonding, influencing its interaction with biological targets. The dimethylethoxycarbonyl group serves as a protective or modifying group, which can affect the compound's stability and reactivity under various conditions. In terms of applications, compounds of this nature may be explored in medicinal chemistry for their potential therapeutic effects, particularly in the development of pharmaceuticals. Overall, the unique combination of functional groups in 2-Chloro-3-[[(1,1-dimethylethoxy)carbonyl]amino]benzeneacetic acid suggests a versatile compound with potential utility in various chemical and biological contexts.

Formula: C₁₃H₁₆ClNO₄

InChI: InChI=1S/C13H16ClNO4/c1-13(2,3)19-12(18)15-9-6-4-5-8(11(9)14)7-10(16)17/h4-6H,7H2,1-3H3,(H,15,18)(H,16,17)

InChI key: InChIKey=BDBHSJANXHFBRC-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1=C(Cl)C(CC(O)=O)=CC=C1

Synonyms:

• Benzeneacetic acid, 2-chloro-3-[[(1,1-dimethylethoxy)carbonyl]amino]-
• 2-Chloro-3-[[(1,1-dimethylethoxy)carbonyl]amino]benzeneacetic acid

2-(3-{[(tert-Butoxy)carbonyl]amino}-2-chlorophenyl)acetic acid

CAS: 672309-92-1

Versatile small molecule scaffold

Formula: C₁₃H₁₆ClNO₄

Purity: Min. 95%

Molecular weight: 285.72 g/mol

Ref: 3D-XBB30992