CAS 672310-14-4
:9H-fluoren-9-ylmethyl (piperidin-3-ylmethyl)carbamate
Description:
9H-fluoren-9-ylmethyl (piperidin-3-ylmethyl)carbamate, identified by its CAS number 672310-14-4, is a chemical compound characterized by its unique structure that combines a fluorenyl group with a piperidine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in medicinal chemistry. The presence of the carbamate functional group suggests that it may participate in hydrogen bonding and could exhibit moderate to high solubility in polar solvents. Additionally, the piperidine ring may impart basicity, influencing its reactivity and interaction with biological targets. The compound's molecular structure allows for potential interactions with various receptors or enzymes, making it of interest in drug development. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 9H-fluoren-9-ylmethyl (piperidin-3-ylmethyl)carbamate represents a versatile scaffold for further exploration in chemical and pharmaceutical research.
Formula:C21H24N2O2
InChI:InChI=1/C21H24N2O2/c24-21(23-13-15-6-5-11-22-12-15)25-14-20-18-9-3-1-7-16(18)17-8-2-4-10-19(17)20/h1-4,7-10,15,20,22H,5-6,11-14H2,(H,23,24)
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=NCC1CCCNC1)O
Synonyms:- Carbamic acid, N-(3-piperidinylmethyl)-, 9H-fluoren-9-ylmethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
