CAS 67262-86-6
:(2S)-3-[(2S,3S,4R,5R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-2-amino-propanoic acid
Description:
The chemical substance with the name "(2S)-3-[(2S,3S,4R,5R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-2-amino-propanoic acid" and CAS number "67262-86-6" is a complex amino acid derivative. It features a chiral center, indicating that it exists in specific stereoisomeric forms, which can significantly influence its biological activity and interactions. The presence of multiple functional groups, including an acetamido group and hydroxyl groups, suggests that this compound may exhibit hydrophilic properties, enhancing its solubility in aqueous environments. The tetrahydropyran ring structure contributes to its cyclic nature, which can affect its conformation and reactivity. This compound is likely to be involved in biochemical processes, potentially serving as a building block for peptides or as a bioactive molecule in pharmaceutical applications. Its specific stereochemistry and functional groups may also play a role in its interactions with enzymes or receptors, making it of interest in medicinal chemistry and biochemistry.
Formula:C11H20N2O8
InChI:InChI=1/C11H20N2O8/c1-4(15)13-7-9(17)8(16)6(2-14)21-11(7)20-3-5(12)10(18)19/h5-9,11,14,16-17H,2-3,12H2,1H3,(H,13,15)(H,18,19)/t5-,6?,7-,8-,9+,11-/m0/s1
Synonyms:- Tn Antigen
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Tn Antigen
CAS:Formula:C11H20N2O8Purity:≥ 95.0%Color and Shape:White to off-white powderMolecular weight:308.292-Acetamido-2-deoxy-a-D-galactopyranosyl serine
CAS:2-Acetamido-2-deoxy-a-D-galactopyranosyl serine (2AGPS) is a naturally occurring glycosaminoglycan. It has been shown to inhibit the growth of cancer cells and to reduce the size of mouse tumors in vivo. This compound also inhibits viral replication in vitro, and its antiviral properties have been shown to work on several different types of viruses, including herpes simplex virus type 1, human cytomegalovirus, and influenza A virus. 2AGPS is also a potent inducer of toll-like receptor 4 signaling pathways in macrophages and dendritic cells. 2AGPS can be synthesized by using a polymerase chain reaction (PCR) technique with synthetic oligosaccharides as a template.Formula:C11H20N2O8Purity:Min. 90 Area-%Color and Shape:Off-White Yellow PowderMolecular weight:308.29 g/mol

